CAS 13189-00-9 appears in our catalog under these names: Zinc methacrylate, Zinc methacrylate, Zinc Methacrylate, >95.0%(T), Zinc(II) methacrylate, 98%. Offered by: GLPBio, Biosynth, TCI, Sigma-Aldrich, Fluorochem. Available pack sizes: 250g, 500g, 2000g, 1000g, 25g, 5000g, 25000g, 10000g.
Zinc bis(2-methylprop-2-enoate) (CAS 13189-00-9) is a chemical compound with the molecular formula C8H10O4Zn and a molecular weight of 235.5 g/mol. IUPAC name: zinc bis(2-methylprop-2-enoate). InChIKey: PIMBTRGLTHJJRV-UHFFFAOYSA-L.
| Molecular formula | C8H10O4Zn |
|---|---|
| Molecular weight | 235.5 g/mol |
| IUPAC name | zinc bis(2-methylprop-2-enoate) |
| InChIKey | PIMBTRGLTHJJRV-UHFFFAOYSA-L |
| SMILES | CC(=C)C(=O)[O-].CC(=C)C(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)