cas: 54010-75-2 — see every product listed under this CAS number, including other names
Zinc trifluoromethanesulfonate, 98% (CAS 54010-75-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 100mg, 5g, 25g, 100g, 500g. Offered by: Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 317090100 |
| cas | 54010-75-2 |
| size | 10g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 10g | 334.97 Pln | |
| Thermo Scientific (Acros) | 50g | 1100.25 Pln | |
| Sigma-Aldrich | 10G | 542.00 Pln | |
| Sigma-Aldrich | 50G | 1070.00 Pln | |
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 169.75 Pln | |
| Fluorochem | 25g | 180.16 Pln | |
| Fluorochem | 100g | 362.39 Pln | |
| Fluorochem | 500g | 1325.59 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
Zinc bis(trifluoromethanesulfonate) (CAS 54010-75-2) is a chemical compound with the molecular formula C2F6O6S2Zn and a molecular weight of 363.5 g/mol. IUPAC name: zinc bis(trifluoromethanesulfonate). InChIKey: CITILBVTAYEWKR-UHFFFAOYSA-L.
| Molecular formula | C2F6O6S2Zn |
|---|---|
| Molecular weight | 363.5 g/mol |
| IUPAC name | zinc bis(trifluoromethanesulfonate) |
| InChIKey | CITILBVTAYEWKR-UHFFFAOYSA-L |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)