CAS 22464-99-9 appears in our catalog under these names: Zirconyl2–ethylhexanoate, Zirconium(IV) oxide 2-ethylhexanoate, in mineral spirits (ó . Offered by: GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 500g.
(2R)-2-ethylhexanoate;(2S)-2-ethylhexanoate;zirconium(2+) (CAS 22464-99-9) is a chemical compound with the molecular formula C16H30O4Zr and a molecular weight of 377.63 g/mol. IUPAC name: (2R)-2-ethylhexanoate;(2S)-2-ethylhexanoate;zirconium(2+). InChIKey: RIYRDRZNXDRTIL-BGEHQDIKSA-L.
| Molecular formula | C16H30O4Zr |
|---|---|
| Molecular weight | 377.63 g/mol |
| IUPAC name | (2R)-2-ethylhexanoate;(2S)-2-ethylhexanoate;zirconium(2+) |
| InChIKey | RIYRDRZNXDRTIL-BGEHQDIKSA-L |
| SMILES | CCCC[C@@H](CC)C(=O)[O-].CCCC[C@H](CC)C(=O)[O-].[Zr+2] |
Computed by PubChem (NCBI)