cas: 90776-59-3 — see every product listed under this CAS number, including other names
beta-Methyl vinyl phosphate (MAP) 97% (CAS 90776-59-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A200530-250mg |
| cas | 90776-59-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 10g | 487.19 Pln | |
| Ambeed | 25g | 909.94 Pln | |
| Ambeed | 100g | 2556.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A200530 |
(4-nitrophenyl)methyl (4R,5R,6S)-3-diphenoxyphosphoryloxy-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (CAS 90776-59-3) is a chemical compound with the molecular formula C29H27N2O10P and a molecular weight of 594.5 g/mol. IUPAC name: (4-nitrophenyl)methyl (4R,5R,6S)-3-diphenoxyphosphoryloxy-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate. InChIKey: STULDTCHQXVRIX-PIYXRGFCSA-N.
| Molecular formula | C29H27N2O10P |
|---|---|
| Molecular weight | 594.5 g/mol |
| IUPAC name | (4-nitrophenyl)methyl (4R,5R,6S)-3-diphenoxyphosphoryloxy-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| InChIKey | STULDTCHQXVRIX-PIYXRGFCSA-N |
| SMILES | C[C@@H]1[C@@H]2[C@H](C(=O)N2C(=C1OP(=O)(OC3=CC=CC=C3)OC4=CC=CC=C4)C(=O)OCC5=CC=C(C=C5)[N+](=O)[O-])[C@@H](C)O |
Computed by PubChem (NCBI)