CAS 35878-28-5 appears in our catalog under these names: Cis-1,2-cyclopentanedicarboxylic anhydride, 95%, CYCLOPENTANE–1,2–DICARBOXYLIC ACID ANHYDRIDE, cis-Cyclopentane-1,2-dicarboxylic acid anhydride, 97%, 97%, Rac-(3ar,6as)-hexahydro-1h-cyclopenta[c]furan-1,3-dione, cis, 97%, cis-Tetrahydro-1H-cyclopenta[c]furan-1,3(3aH)-dione, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
(3aR,6aS)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-1,3-dione (CAS 35878-28-5) is a chemical compound with the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. IUPAC name: (3aR,6aS)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-1,3-dione. InChIKey: NMSRALOLNIBERV-SYDPRGILSA-N.
| Molecular formula | C7H8O3 |
|---|---|
| Molecular weight | 140.14 g/mol |
| IUPAC name | (3aR,6aS)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-1,3-dione |
| InChIKey | NMSRALOLNIBERV-SYDPRGILSA-N |
| SMILES | C1C[C@@H]2[C@H](C1)C(=O)OC2=O |
Computed by PubChem (NCBI)