cas: 2138299-33-7 — see every product listed under this CAS number, including other names
diABZI STING agonist-1 99% (CAS 2138299-33-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1250006-1mg |
| cas | 2138299-33-7 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 693.00 Pln | |
| Ambeed | 5mg | 1627.50 Pln | |
| Ambeed | 10mg | 2495.25 Pln | |
| Ambeed | 25mg | 4931.62 Pln | |
| Ambeed | 50mg | 7979.87 Pln | |
| Ambeed | 100mg | 12730.25 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1250006 |
1-[(E)-4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-(3-morpholin-4-ylpropoxy)benzimidazol-1-yl]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazole-5-carboxamide (CAS 2138299-33-7) is a chemical compound with the molecular formula C42H51N13O7 and a molecular weight of 849.9 g/mol. IUPAC name: 1-[(E)-4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-(3-morpholin-4-ylpropoxy)benzimidazol-1-yl]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazole-5-carboxamide. InChIKey: JGLMVXWAHNTPRF-CMDGGOBGSA-N.
| Molecular formula | C42H51N13O7 |
|---|---|
| Molecular weight | 849.9 g/mol |
| IUPAC name | 1-[(E)-4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-(3-morpholin-4-ylpropoxy)benzimidazol-1-yl]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazole-5-carboxamide |
| InChIKey | JGLMVXWAHNTPRF-CMDGGOBGSA-N |
| SMILES | CCN1C(=CC(=N1)C)C(=O)NC2=NC3=C(N2C/C=C/CN4C5=C(C=C(C=C5OCCCN6CCOCC6)C(=O)N)N=C4NC(=O)C7=CC(=NN7CC)C)C(=CC(=C3)C(=O)N)OC |
Computed by PubChem (NCBI)