cas: 1878181-34-0 — see every product listed under this CAS number, including other names
dimethyl 7-bromopyrazolo[1,5-a]pyridine-2,3-dicarboxylate, 97% (CAS 1878181-34-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12JW6K-100mg |
| cas | 1878181-34-0 |
| size | 100mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 664.40 Pln | |
| Chemat | 500mg | 923.60 Pln | |
| Chemat | 1g | 1350.80 Pln | |
| Chemat | 5g | 3918.80 Pln | |
| Fluorochem | 100mg | 768.50 Pln | |
| Fluorochem | 250mg | 1226.67 Pln | |
| Fluorochem | 500mg | 1700.46 Pln | |
| Fluorochem | 1g | 2512.67 Pln | |
| Fluorochem | 5g | 7136.05 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 7-bromopyrazolo[1,5-a]pyridine-2,3-dicarboxylate (CAS 1878181-34-0) is a chemical compound with the molecular formula C11H9BrN2O4 and a molecular weight of 313.10 g/mol. IUPAC name: dimethyl 7-bromopyrazolo[1,5-a]pyridine-2,3-dicarboxylate. InChIKey: VGSHEPCHNJOWLL-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O4 |
|---|---|
| Molecular weight | 313.10 g/mol |
| IUPAC name | dimethyl 7-bromopyrazolo[1,5-a]pyridine-2,3-dicarboxylate |
| InChIKey | VGSHEPCHNJOWLL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=CC=C(N2N=C1C(=O)OC)Br |
Computed by PubChem (NCBI)