cas: 1394346-20-3 — see every product listed under this CAS number, including other names
dimethyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)phosphine oxide, 95%, 95% (CAS 1394346-20-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112B1C-50mg |
| cas | 1394346-20-3 |
| size | 50mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 429.20 Pln | |
| Chemat | 100mg | 645.20 Pln | |
| Chemat | 250mg | 1226.00 Pln | |
| Chemat | 1g | 3026.00 Pln | |
| Chemat | 5g | 11594.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-dimethylphosphorylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1394346-20-3) is a chemical compound with the molecular formula C14H22BO3P and a molecular weight of 280.11 g/mol. IUPAC name: 2-(4-dimethylphosphorylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XFBGUSJMWBCZDC-UHFFFAOYSA-N.
| Molecular formula | C14H22BO3P |
|---|---|
| Molecular weight | 280.11 g/mol |
| IUPAC name | 2-(4-dimethylphosphorylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XFBGUSJMWBCZDC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)P(=O)(C)C |
Computed by PubChem (NCBI)