cas: 2141976-33-0 — see every product listed under this CAS number, including other names
endo-BCN-PEG3-Maleimide, 99% (CAS 2141976-33-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K6OP-1mg |
| cas | 2141976-33-0 |
| size | 1mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 246.80 Pln | |
| Chemat | 5mg | 534.80 Pln | |
| Chemat | 10mg | 563.60 Pln | |
| Chemat | 25mg | 914.00 Pln | |
| Chemat | 50mg | 1514.00 Pln | |
| Chemat | 100mg | 2526.80 Pln | |
| Chemat | 250mg | 4250.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 2141976-33-0) is a chemical compound with the molecular formula C26H37N3O8 and a molecular weight of 519.6 g/mol. IUPAC name: [(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: ZZRUYTQNTVMKLG-CBQGHPETSA-N.
| Molecular formula | C26H37N3O8 |
|---|---|
| Molecular weight | 519.6 g/mol |
| IUPAC name | [(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | ZZRUYTQNTVMKLG-CBQGHPETSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2COC(=O)NCCOCCOCCOCCNC(=O)CCN3C(=O)C=CC3=O)CCC#C1 |
Computed by PubChem (NCBI)