cas: 288251-84-3 — see every product listed under this CAS number, including other names
ethyl 1-(2-cyano-4-nitrophenyl)piperidine-4-carboxylate, 97% (CAS 288251-84-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F366308-250MG |
| cas | 288251-84-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 1g | 1382.86 Pln | |
| Fluorochem | 5g | 3371.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 1-(2-cyano-4-nitrophenyl)piperidine-4-carboxylate (CAS 288251-84-3) is a chemical compound with the molecular formula C15H17N3O4 and a molecular weight of 303.31 g/mol. IUPAC name: ethyl 1-(2-cyano-4-nitrophenyl)piperidine-4-carboxylate. InChIKey: AAWOWAKNYZULEN-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O4 |
|---|---|
| Molecular weight | 303.31 g/mol |
| IUPAC name | ethyl 1-(2-cyano-4-nitrophenyl)piperidine-4-carboxylate |
| InChIKey | AAWOWAKNYZULEN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1)C2=C(C=C(C=C2)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)