cas: 186340-03-4 — see every product listed under this CAS number, including other names
ethyl 5-amino-1-(1,3-benzothiazol-2-yl)-1H-pyrazole-4-carboxylate (CAS 186340-03-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F349144-250MG |
| cas | 186340-03-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 799.74 Pln | |
| Fluorochem | 500mg | 1174.60 Pln | |
| Fluorochem | 1g | 1611.95 Pln |
| delivery time | 2-3 weeks |
|---|
Ethyl 5-amino-1-(1,3-benzothiazol-2-yl)pyrazole-4-carboxylate (CAS 186340-03-4) is a chemical compound with the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. IUPAC name: ethyl 5-amino-1-(1,3-benzothiazol-2-yl)pyrazole-4-carboxylate. InChIKey: LIEMNSUQOUBJOG-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O2S |
|---|---|
| Molecular weight | 288.33 g/mol |
| IUPAC name | ethyl 5-amino-1-(1,3-benzothiazol-2-yl)pyrazole-4-carboxylate |
| InChIKey | LIEMNSUQOUBJOG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=NC3=CC=CC=C3S2)N |
Computed by PubChem (NCBI)