cas: 1807501-87-6 — see every product listed under this CAS number, including other names
exo-BCN-PEG2-Boc-amine 95% (CAS 1807501-87-6) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756400-25mg |
| cas | 1807501-87-6 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 998.94 Pln | |
| Ambeed | 50mg | 1549.62 Pln | |
| Ambeed | 100mg | 2428.50 Pln | |
| Ambeed | 250mg | 4063.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A756400 |
Tert-butyl N-[2-[2-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)ethoxy]ethoxy]ethyl]carbamate (CAS 1807501-87-6) is a chemical compound with the molecular formula C22H36N2O6 and a molecular weight of 424.5 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)ethoxy]ethoxy]ethyl]carbamate. InChIKey: XPXWWKJBIIPHLJ-UHFFFAOYSA-N.
| Molecular formula | C22H36N2O6 |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | XPXWWKJBIIPHLJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC(=O)OCC1C2C1CCC#CCC2 |
Computed by PubChem (NCBI)