cas: 1147558-40-4 — see every product listed under this CAS number, including other names
exo-tert-Butyl 3-cyano-8-azabicyclo[3.2.1]octane-8-carboxylate 98% (CAS 1147558-40-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A263612-100mg |
| cas | 1147558-40-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 364.81 Pln | |
| Ambeed | 250mg | 509.44 Pln | |
| Ambeed | 1g | 1265.94 Pln | |
| Ambeed | 5g | 4503.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A263612 |
Tert-butyl (1S,5R)-3-cyano-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 1147558-40-4) is a chemical compound with the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. IUPAC name: tert-butyl (1S,5R)-3-cyano-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: UVURMTGIVKSLEM-FGWVZKOKSA-N.
| Molecular formula | C13H20N2O2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | tert-butyl (1S,5R)-3-cyano-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | UVURMTGIVKSLEM-FGWVZKOKSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(C2)C#N |
Computed by PubChem (NCBI)