m-PEG17-acid, 98%
cas: 2346581-96-0 — see every product listed under this CAS number, including other names
m-PEG17-acid, 98% (CAS 2346581-96-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A750533-250mg |
| cas | 2346581-96-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 982.25 Pln | |
| Ambeed | 5g | 3235.06 Pln | |
| Ambeed | 10g | 5448.94 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 606.80 Pln | |
| Chemat | 5g | 1960.40 Pln | |
| Chemat | 10g | 3429.20 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 1g | 1008.00 Pln | |
| Fluorochem | 5g | 3304.06 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2346581-96-0) is a chemical compound with the molecular formula C36H72O19 and a molecular weight of 808.9 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: AAJZUTNLESPXOT-UHFFFAOYSA-N.
| Molecular formula | C36H72O19 |
|---|---|
| Molecular weight | 808.9 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | AAJZUTNLESPXOT-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)