CAS 2055016-25-4 appears in our catalog under these names: M-Peg9-phosphonic acid, 95%, m–PEG9–phosphonic acid, m-PEG9-phosphonic acid, 98%, 98%, m-PEG9-phosphonic acid, 99.33%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 100mg, 1g, 50 mg, 25 mg.
2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylphosphonic acid (CAS 2055016-25-4) is a chemical compound with the molecular formula C19H41O12P and a molecular weight of 492.5 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylphosphonic acid. InChIKey: UEQSLJQFVIWCCW-UHFFFAOYSA-N.
| Molecular formula | C19H41O12P |
|---|---|
| Molecular weight | 492.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylphosphonic acid |
| InChIKey | UEQSLJQFVIWCCW-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCP(=O)(O)O |
Computed by PubChem (NCBI)