m-dPEG12-acid, 98%
cas: 2135793-73-4 — see every product listed under this CAS number, including other names
m-dPEG12-acid, 98% (CAS 2135793-73-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JLPV-100mg |
| cas | 2135793-73-4 |
| size | 100mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1235.60 Pln | |
| Chemat | 25g | 2819.60 Pln | |
| Chemat | 50g | 4888.40 Pln | |
| Chemat | 100g | 9650.00 Pln | |
| Chemat | 250g | 22206.80 Pln | |
| Chemat | 500g | 37046.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2135793-73-4) is a chemical compound with the molecular formula C26H52O14 and a molecular weight of 588.7 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: JMAKFNFKUHXFBH-UHFFFAOYSA-N.
| Molecular formula | C26H52O14 |
|---|---|
| Molecular weight | 588.7 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | JMAKFNFKUHXFBH-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)