methyl (2R)-2-(benzyloxycarbonylamino)-2-(oxetan-3-yl)acetate, 97%
cas: 1213783-61-9 — see every product listed under this CAS number, including other names
methyl (2R)-2-(benzyloxycarbonylamino)-2-(oxetan-3-yl)acetate, 97% (CAS 1213783-61-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12XA27-100mg |
| cas | 1213783-61-9 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 500mg | 722.00 Pln | |
| Chemat | 1g | 856.40 Pln | |
| Chemat | 5g | 2450.00 Pln | |
| Chemat | 10g | 4043.60 Pln | |
| Fluorochem | 100mg | 591.48 Pln | |
| Fluorochem | 250mg | 716.43 Pln | |
| Fluorochem | 500mg | 1330.80 Pln | |
| Fluorochem | 1g | 1591.12 Pln | |
| Fluorochem | 5g | 4543.21 Pln | |
| Fluorochem | 10g | 7359.93 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-2-(oxetan-3-yl)-2-(phenylmethoxycarbonylamino)acetate (CAS 1213783-61-9) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: methyl (2R)-2-(oxetan-3-yl)-2-(phenylmethoxycarbonylamino)acetate. InChIKey: CPWNUOJLLPXDNI-GFCCVEGCSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | methyl (2R)-2-(oxetan-3-yl)-2-(phenylmethoxycarbonylamino)acetate |
| InChIKey | CPWNUOJLLPXDNI-GFCCVEGCSA-N |
| SMILES | COC(=O)[C@@H](C1COC1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)