cas: 54202-09-4 — see every product listed under this CAS number, including other names
methyl 4-(aminomethyl)bicyclo[2.2.2]octane-1-carboxylate 97% (CAS 54202-09-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A281698-100mg |
| cas | 54202-09-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 509.44 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1761.00 Pln | |
| Ambeed | 5g | 6511.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A281698 |
Methyl 4-(aminomethyl)bicyclo[2.2.2]octane-1-carboxylate (CAS 54202-09-4) is a chemical compound with the molecular formula C11H19NO2 and a molecular weight of 197.27 g/mol. IUPAC name: methyl 4-(aminomethyl)bicyclo[2.2.2]octane-1-carboxylate. InChIKey: IFLWFAYRFUPNPT-UHFFFAOYSA-N.
| Molecular formula | C11H19NO2 |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | methyl 4-(aminomethyl)bicyclo[2.2.2]octane-1-carboxylate |
| InChIKey | IFLWFAYRFUPNPT-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCC(CC1)(CC2)CN |
Computed by PubChem (NCBI)