cas: 848369-55-1 — see every product listed under this CAS number, including other names
methyl 6-(4-oxo-2-sulfanylidene-1,2,3,4-tetrahydroquinazolin-3-yl)hexanoate, 95% (CAS 848369-55-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F652304-100MG |
| cas | 848369-55-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 721.64 Pln | |
| Fluorochem | 250mg | 981.96 Pln | |
| Fluorochem | 500mg | 1815.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoate (CAS 848369-55-1) is a chemical compound with the molecular formula C15H18N2O3S and a molecular weight of 306.4 g/mol. IUPAC name: methyl 6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoate. InChIKey: DLRPJYDZCKNGOT-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O3S |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | methyl 6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoate |
| InChIKey | DLRPJYDZCKNGOT-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCCCN1C(=O)C2=CC=CC=C2NC1=S |
Computed by PubChem (NCBI)