cas: 706820-95-3 — see every product listed under this CAS number, including other names
n-(Tert-butyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide, 95% (CAS 706820-95-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696414-100MG |
| cas | 706820-95-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 534.20 Pln | |
| Fluorochem | 1g | 1237.08 Pln | |
| Fluorochem | 5g | 4157.93 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
N-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (CAS 706820-95-3) is a chemical compound with the molecular formula C16H26BNO4S and a molecular weight of 339.3 g/mol. IUPAC name: N-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide. InChIKey: VSJNPEGKWGUNOP-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO4S |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | N-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| InChIKey | VSJNPEGKWGUNOP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)(=O)NC(C)(C)C |
Computed by PubChem (NCBI)