cas: 914610-50-7 — see every product listed under this CAS number, including other names
n-Cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide, 98% (CAS 914610-50-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 100mg, 10g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F694211-1G |
| cas | 914610-50-7 |
| size | 1g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 992.38 Pln | |
| Fluorochem | 25g | 3356.13 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 971.12 Pln | |
| Ambeed | 25g | 3279.56 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 616.40 Pln | |
| Chemat | 10g | 1067.60 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
N-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (CAS 914610-50-7) is a chemical compound with the molecular formula C15H22BNO4S and a molecular weight of 323.2 g/mol. IUPAC name: N-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide. InChIKey: ASFBWQXCZSUHRX-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO4S |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | N-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| InChIKey | ASFBWQXCZSUHRX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)NC3CC3 |
Computed by PubChem (NCBI)