CAS 443913-15-3 appears in our catalog under these names: p38-α MAPK-IN-1/ 99.52% (existing batch purity), p38–α MAPK–IN–1, 1-(3-(tert-Butyl)-1-(p-tolyl)-1H-pyrazol-5-yl)-3-(4-(2-morpholinoethoxy)phenyl)urea, 98%, 98%, p38-α MAPK-IN-1, 99.71%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-(2-morpholin-4-ylethoxy)phenyl]urea (CAS 443913-15-3) is a chemical compound with the molecular formula C27H35N5O3 and a molecular weight of 477.6 g/mol. IUPAC name: 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-(2-morpholin-4-ylethoxy)phenyl]urea. InChIKey: FRZNJFWQVYAVCE-UHFFFAOYSA-N.
| Molecular formula | C27H35N5O3 |
|---|---|
| Molecular weight | 477.6 g/mol |
| IUPAC name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-(2-morpholin-4-ylethoxy)phenyl]urea |
| InChIKey | FRZNJFWQVYAVCE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CC(=N2)C(C)(C)C)NC(=O)NC3=CC=C(C=C3)OCCN4CCOCC4 |
Computed by PubChem (NCBI)