CAS 158013-43-5 appears in our catalog under these names: para-iodoHoechst 33258, 98+%, para-iodoHoechst 33258, 2'-(4-Iodophenyl)-6-(4-methylpiperazin-1-yl)-1H,3'H-2,5'-bibenzo[d]imidazole, 99.73%, 99.73%, para-iodoHoechst 33258, 98.94%. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 5mg, 10mg, 1mg, 100 mg, 5 mg, 25 mg, 50 mg.
2-(4-iodophenyl)-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole (CAS 158013-43-5) is a chemical compound with the molecular formula C25H23IN6 and a molecular weight of 534.4 g/mol. IUPAC name: 2-(4-iodophenyl)-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole. InChIKey: WSBVZEKIZWIJQO-UHFFFAOYSA-N.
| Molecular formula | C25H23IN6 |
|---|---|
| Molecular weight | 534.4 g/mol |
| IUPAC name | 2-(4-iodophenyl)-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole |
| InChIKey | WSBVZEKIZWIJQO-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC=C(C=C6)I |
Computed by PubChem (NCBI)