cas: 1612792-88-7 — see every product listed under this CAS number, including other names
potassium rac-((1R,2R)-2-(ethoxycarbonyl)cyclopropyl)trifluoroborate, 98%, 98% (CAS 1612792-88-7) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 250g, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DVRV-50g |
| cas | 1612792-88-7 |
| size | 50g |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 7067.60 Pln | |
| Chemat | 100g | 13346.00 Pln | |
| Chemat | 250g | 26637.20 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 500mg | 318.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1576.40 Pln | |
| Chemat | 10g | 2819.60 Pln | |
| Chemat | 25g | 5574.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Potassium [(1R,2R)-2-ethoxycarbonylcyclopropyl]-trifluoroboranuide (CAS 1612792-88-7) is a chemical compound with the molecular formula C6H9BF3KO2 and a molecular weight of 220.04 g/mol. IUPAC name: potassium [(1R,2R)-2-ethoxycarbonylcyclopropyl]-trifluoroboranuide. InChIKey: NRHPDVGKTYUQNC-TYSVMGFPSA-N.
| Molecular formula | C6H9BF3KO2 |
|---|---|
| Molecular weight | 220.04 g/mol |
| IUPAC name | potassium [(1R,2R)-2-ethoxycarbonylcyclopropyl]-trifluoroboranuide |
| InChIKey | NRHPDVGKTYUQNC-TYSVMGFPSA-N |
| SMILES | [B-]([C@@H]1C[C@H]1C(=O)OCC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)