CAS 1005173-83-0 is the registry number for (1S,2S)-1,2-Di-o-tolylethane-1,2-diamine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1S,2S)-1,2-bis(2-methylphenyl)ethane-1,2-diamine (CAS 1005173-83-0) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: (1S,2S)-1,2-bis(2-methylphenyl)ethane-1,2-diamine. InChIKey: HKBNVGISGVWESI-HOTGVXAUSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | (1S,2S)-1,2-bis(2-methylphenyl)ethane-1,2-diamine |
| InChIKey | HKBNVGISGVWESI-HOTGVXAUSA-N |
| SMILES | CC1=CC=CC=C1[C@@H]([C@H](C2=CC=CC=C2C)N)N |
Computed by PubChem (NCBI)