CAS 1018053-30-9 is the registry number for 3-(7-(Difluoromethyl)-5-methyl-(1,2,4)triazolo(1,5-a)pyrimidin-2-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-[7-(difluoromethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propanoic acid (CAS 1018053-30-9) is a chemical compound with the molecular formula C10H10F2N4O2 and a molecular weight of 256.21 g/mol. IUPAC name: 3-[7-(difluoromethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propanoic acid. InChIKey: UJSUJLCGNIRFRU-UHFFFAOYSA-N.
| Molecular formula | C10H10F2N4O2 |
|---|---|
| Molecular weight | 256.21 g/mol |
| IUPAC name | 3-[7-(difluoromethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propanoic acid |
| InChIKey | UJSUJLCGNIRFRU-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=NN2C(=C1)C(F)F)CCC(=O)O |
Computed by PubChem (NCBI)