CAS 1021018-93-8 is the registry number for 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-fluoren-9-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-one (CAS 1021018-93-8) is a chemical compound with the molecular formula C19H19BO3 and a molecular weight of 306.2 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-one. InChIKey: MWZKAFYBIWGVDG-UHFFFAOYSA-N.
| Molecular formula | C19H19BO3 |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-one |
| InChIKey | MWZKAFYBIWGVDG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C4=CC=CC=C4C(=O)C3=CC=C2 |
Computed by PubChem (NCBI)