CAS 1021957-30-1 is the registry number for 4,4′′-Difluoro[1,1′:4′,1′′-terphenyl]-2′,5′-dicarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,5-bis(4-fluorophenyl)terephthalic acid (CAS 1021957-30-1) is a chemical compound with the molecular formula C20H12F2O4 and a molecular weight of 354.3 g/mol. IUPAC name: 2,5-bis(4-fluorophenyl)terephthalic acid. InChIKey: GOYCOSOBJJDKPM-UHFFFAOYSA-N.
| Molecular formula | C20H12F2O4 |
|---|---|
| Molecular weight | 354.3 g/mol |
| IUPAC name | 2,5-bis(4-fluorophenyl)terephthalic acid |
| InChIKey | GOYCOSOBJJDKPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2C(=O)O)C3=CC=C(C=C3)F)C(=O)O)F |
Computed by PubChem (NCBI)