Products 1021957-30-1

CAS 1021957-30-1 is the registry number for 4,4′′-Difluoro[1,1′:4′,1′′-terphenyl]-2′,5′-dicarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2,5-bis(4-fluorophenyl)terephthalic acid (CAS 1021957-30-1) is a chemical compound with the molecular formula C20H12F2O4 and a molecular weight of 354.3 g/mol. IUPAC name: 2,5-bis(4-fluorophenyl)terephthalic acid. InChIKey: GOYCOSOBJJDKPM-UHFFFAOYSA-N.

Identity
Molecular formulaC20H12F2O4
Molecular weight354.3 g/mol
IUPAC name2,5-bis(4-fluorophenyl)terephthalic acid
InChIKeyGOYCOSOBJJDKPM-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC(=C(C=C2C(=O)O)C3=CC=C(C=C3)F)C(=O)O)F

Computed by PubChem (NCBI)