Products 102878-28-4

CAS 102878-28-4 is the registry number for 2-Allyl-6-aminophenol, 98%, 98%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-6-prop-2-enylphenol (CAS 102878-28-4) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: 2-amino-6-prop-2-enylphenol. InChIKey: RHZVFQVPMKWIKM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO
Molecular weight149.19 g/mol
IUPAC name2-amino-6-prop-2-enylphenol
InChIKeyRHZVFQVPMKWIKM-UHFFFAOYSA-N
SMILESC=CCC1=C(C(=CC=C1)N)O

Computed by PubChem (NCBI)