CAS 1039749-93-3 is the registry number for N-(3-Azidopropyl)-7-nitro-2,1,3-benzoxadiazol-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
N-(3-azidopropyl)-4-nitro-2,1,3-benzoxadiazol-7-amine (CAS 1039749-93-3) is a chemical compound with the molecular formula C9H9N7O3 and a molecular weight of 263.21 g/mol. IUPAC name: N-(3-azidopropyl)-4-nitro-2,1,3-benzoxadiazol-7-amine. InChIKey: BGQDKKFZKGONQP-UHFFFAOYSA-N.
| Molecular formula | C9H9N7O3 |
|---|---|
| Molecular weight | 263.21 g/mol |
| IUPAC name | N-(3-azidopropyl)-4-nitro-2,1,3-benzoxadiazol-7-amine |
| InChIKey | BGQDKKFZKGONQP-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)[N+](=O)[O-])NCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)