Products 1041431-21-3
CAS 1041431-21-3 is the registry number for Ethyl (E)-3-(2-Chlorocyclopent-1-en-1-yl)acrylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl (E)-3-(2-chlorocyclopenten-1-yl)prop-2-enoate (CAS 1041431-21-3) is a chemical compound with the molecular formula C10H13ClO2 and a molecular weight of 200.66 g/mol. IUPAC name: ethyl (E)-3-(2-chlorocyclopenten-1-yl)prop-2-enoate. InChIKey: RAIKHAJHKGFHEX-VOTSOKGWSA-N.
| Molecular formula | C10H13ClO2 |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | ethyl (E)-3-(2-chlorocyclopenten-1-yl)prop-2-enoate |
| InChIKey | RAIKHAJHKGFHEX-VOTSOKGWSA-N |
| SMILES | CCOC(=O)/C=C/C1=C(CCC1)Cl |
Computed by PubChem (NCBI)