CAS 1052-32-0 is the registry number for Thiamine Benzoate Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
2-[3-[(4-amino-2-methylpyrimidin-1-ium-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl benzoate dichloride (CAS 1052-32-0) is a chemical compound with the molecular formula C19H22Cl2N4O2S and a molecular weight of 441.4 g/mol. IUPAC name: 2-[3-[(4-amino-2-methylpyrimidin-1-ium-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl benzoate dichloride. InChIKey: VVIAAKNVDRRCLK-UHFFFAOYSA-M.
| Molecular formula | C19H22Cl2N4O2S |
|---|---|
| Molecular weight | 441.4 g/mol |
| IUPAC name | 2-[3-[(4-amino-2-methylpyrimidin-1-ium-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl benzoate dichloride |
| InChIKey | VVIAAKNVDRRCLK-UHFFFAOYSA-M |
| SMILES | CC1=C(SC=[N+]1CC2=C[NH+]=C(N=C2N)C)CCOC(=O)C3=CC=CC=C3.[Cl-].[Cl-] |
Computed by PubChem (NCBI)