Products 105309-62-4
CAS 105309-62-4 is the registry number for Benzoic-carboxy-13C acid, 4,4′,4′′,4′′′-methanetetrayltetrakis-, tetramethyl ester, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 4-[tris(4-methoxycarbonylphenyl)methyl]benzoate (CAS 105309-62-4) is a chemical compound with the molecular formula C33H28O8 and a molecular weight of 556.5 g/mol. IUPAC name: methyl 4-[tris(4-methoxycarbonylphenyl)methyl]benzoate. InChIKey: ZJEXWZXSMAAKLJ-PVZSCHDPSA-N.
| Molecular formula | C33H28O8 |
|---|---|
| Molecular weight | 556.5 g/mol |
| IUPAC name | methyl 4-[tris(4-methoxycarbonylphenyl)methyl]benzoate |
| InChIKey | ZJEXWZXSMAAKLJ-PVZSCHDPSA-N |
| SMILES | CO[13C](=O)C1=CC=C(C=C1)C(C2=CC=C(C=C2)[13C](=O)OC)(C3=CC=C(C=C3)[13C](=O)OC)C4=CC=C(C=C4)[13C](=O)OC |
Computed by PubChem (NCBI)