CAS 1055035-67-0 appears in our catalog under these names: Oseltamivir Impurity 91, Oseltamivir Impurity 80, Ethyl (3R,4R,5S)-4-amino-5-(diallylamino)-3-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R,4R,5S)-4-amino-5-[bis(prop-2-enyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate (CAS 1055035-67-0) is a chemical compound with the molecular formula C20H34N2O3 and a molecular weight of 350.5 g/mol. IUPAC name: ethyl (3R,4R,5S)-4-amino-5-[bis(prop-2-enyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate. InChIKey: XKRZVDIHPWVWIB-IPMKNSEASA-N.
| Molecular formula | C20H34N2O3 |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | ethyl (3R,4R,5S)-4-amino-5-[bis(prop-2-enyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate |
| InChIKey | XKRZVDIHPWVWIB-IPMKNSEASA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1N)N(CC=C)CC=C)C(=O)OCC |
Computed by PubChem (NCBI)