CAS 105537-49-3 is the registry number for 6-(4-Nitrophenyl)pyridazin-3(2H)-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(4-nitrophenyl)-1H-pyridazin-6-one (CAS 105537-49-3) is a chemical compound with the molecular formula C10H7N3O3 and a molecular weight of 217.18 g/mol. IUPAC name: 3-(4-nitrophenyl)-1H-pyridazin-6-one. InChIKey: IKBFYMXTFYZVAS-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O3 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | 3-(4-nitrophenyl)-1H-pyridazin-6-one |
| InChIKey | IKBFYMXTFYZVAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=O)C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)