CAS 1058706-32-3 appears in our catalog under these names: Sotrastaurin, 95%, Aeb-071, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-(1H-indol-3-yl)-4-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]pyrrole-2,5-dione;hydrochloride (CAS 1058706-32-3) is a chemical compound with the molecular formula C25H23ClN6O2 and a molecular weight of 474.9 g/mol. IUPAC name: 3-(1H-indol-3-yl)-4-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]pyrrole-2,5-dione;hydrochloride. InChIKey: ZDEDHGJNAAGSHW-UHFFFAOYSA-N.
| Molecular formula | C25H23ClN6O2 |
|---|---|
| Molecular weight | 474.9 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)-4-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]pyrrole-2,5-dione;hydrochloride |
| InChIKey | ZDEDHGJNAAGSHW-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=CC=CC=C3C(=N2)C4=C(C(=O)NC4=O)C5=CNC6=CC=CC=C65.Cl |
Computed by PubChem (NCBI)