Products 1065569-98-3
CAS 1065569-98-3 is the registry number for cyanomethyl (2S)-2-[(2-chloroacetyl)amino]-3-(1H-indol-3-yl)propanoate, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Cyanomethyl (2S)-2-[(2-chloroacetyl)amino]-3-(1H-indol-3-yl)propanoate (CAS 1065569-98-3) is a chemical compound with the molecular formula C15H14ClN3O3 and a molecular weight of 319.74 g/mol. IUPAC name: cyanomethyl (2S)-2-[(2-chloroacetyl)amino]-3-(1H-indol-3-yl)propanoate. InChIKey: CHJWEQVZWMNCAJ-ZDUSSCGKSA-N.
| Molecular formula | C15H14ClN3O3 |
|---|---|
| Molecular weight | 319.74 g/mol |
| IUPAC name | cyanomethyl (2S)-2-[(2-chloroacetyl)amino]-3-(1H-indol-3-yl)propanoate |
| InChIKey | CHJWEQVZWMNCAJ-ZDUSSCGKSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)OCC#N)NC(=O)CCl |
Computed by PubChem (NCBI)