Products 1069110-72-0
CAS 1069110-72-0 is the registry number for J10-1, 99.92%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 10 mg, 100 mg, 50 mg.
3-[2-(3,4-dichloroanilino)-2-oxoethyl]-5,6,7-trifluoro-1H-indole-2-carboxylic acid (CAS 1069110-72-0) is a chemical compound with the molecular formula C17H9Cl2F3N2O3 and a molecular weight of 417.2 g/mol. IUPAC name: 3-[2-(3,4-dichloroanilino)-2-oxoethyl]-5,6,7-trifluoro-1H-indole-2-carboxylic acid. InChIKey: XWTOEZDPMQBBMY-UHFFFAOYSA-N.
| Molecular formula | C17H9Cl2F3N2O3 |
|---|---|
| Molecular weight | 417.2 g/mol |
| IUPAC name | 3-[2-(3,4-dichloroanilino)-2-oxoethyl]-5,6,7-trifluoro-1H-indole-2-carboxylic acid |
| InChIKey | XWTOEZDPMQBBMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CC2=C(NC3=C(C(=C(C=C23)F)F)F)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)