CAS 1078503-71-5 is the registry number for (3AR,3bR,4aS,5S,5aS)-2,2-dimethylhexahydrocyclopropa[3,4]cyclopenta[1,2-d][1,3]dioxol-5-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R,4S,5S,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-ol (CAS 1078503-71-5) is a chemical compound with the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. IUPAC name: (1R,2R,4S,5S,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-ol. InChIKey: MAQPKLNGHGQJGE-YMVPXFTJSA-N.
| Molecular formula | C9H14O3 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | (1R,2R,4S,5S,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-ol |
| InChIKey | MAQPKLNGHGQJGE-YMVPXFTJSA-N |
| SMILES | CC1(O[C@@H]2[C@@H]3C[C@@H]3[C@@H]([C@@H]2O1)O)C |
Computed by PubChem (NCBI)