Products 1082798-37-5
CAS 1082798-37-5 is the registry number for N-(2,4-Dimethylphenyl)-2-[(2,5-dimethylphenyl)amino]acetamide, 95%. Offered by: Chemat. Available pack sizes: 100mg.
2-(2,5-dimethylanilino)-N-(2,4-dimethylphenyl)acetamide (CAS 1082798-37-5) is a chemical compound with the molecular formula C18H22N2O and a molecular weight of 282.4 g/mol. IUPAC name: 2-(2,5-dimethylanilino)-N-(2,4-dimethylphenyl)acetamide. InChIKey: VBASZWOQVCRMHO-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 2-(2,5-dimethylanilino)-N-(2,4-dimethylphenyl)acetamide |
| InChIKey | VBASZWOQVCRMHO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)CNC2=C(C=CC(=C2)C)C)C |
Computed by PubChem (NCBI)