Products 1092559-67-5
CAS 1092559-67-5 is the registry number for 2,5-Dioxopyrrolidin-1-yl 1,3-dimethoxy-1,3-dihydroisobenzofuran-5-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
(2,5-dioxopyrrolidin-1-yl) 1,3-dimethoxy-1,3-dihydro-2-benzofuran-5-carboxylate (CAS 1092559-67-5) is a chemical compound with the molecular formula C15H15NO7 and a molecular weight of 321.28 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 1,3-dimethoxy-1,3-dihydro-2-benzofuran-5-carboxylate. InChIKey: RKHPEAHXFQHRRM-UHFFFAOYSA-N.
| Molecular formula | C15H15NO7 |
|---|---|
| Molecular weight | 321.28 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 1,3-dimethoxy-1,3-dihydro-2-benzofuran-5-carboxylate |
| InChIKey | RKHPEAHXFQHRRM-UHFFFAOYSA-N |
| SMILES | COC1C2=C(C=C(C=C2)C(=O)ON3C(=O)CCC3=O)C(O1)OC |
Computed by PubChem (NCBI)