Products 1094286-24-4

CAS 1094286-24-4 is the registry number for Methyl 2-(cyclopentylamino)benzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-(cyclopentylamino)benzoate (CAS 1094286-24-4) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: methyl 2-(cyclopentylamino)benzoate. InChIKey: BIXOUDDOWSNVOO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO2
Molecular weight219.28 g/mol
IUPAC namemethyl 2-(cyclopentylamino)benzoate
InChIKeyBIXOUDDOWSNVOO-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC=C1NC2CCCC2

Computed by PubChem (NCBI)