CAS 1094566-37-6 is the registry number for Amino Hydroxynimesulide NAC Adduct. Offered by: TRC. Available pack sizes: 10mg, 1mg.
(2R)-2-acetamido-3-[2-amino-4-(4-hydroxyphenoxy)-5-(methanesulfonamido)phenyl]sulfanylpropanoic acid (CAS 1094566-37-6) is a chemical compound with the molecular formula C18H21N3O7S2 and a molecular weight of 455.5 g/mol. IUPAC name: (2R)-2-acetamido-3-[2-amino-4-(4-hydroxyphenoxy)-5-(methanesulfonamido)phenyl]sulfanylpropanoic acid. InChIKey: LAPPXTHNOPTGSG-HNNXBMFYSA-N.
| Molecular formula | C18H21N3O7S2 |
|---|---|
| Molecular weight | 455.5 g/mol |
| IUPAC name | (2R)-2-acetamido-3-[2-amino-4-(4-hydroxyphenoxy)-5-(methanesulfonamido)phenyl]sulfanylpropanoic acid |
| InChIKey | LAPPXTHNOPTGSG-HNNXBMFYSA-N |
| SMILES | CC(=O)N[C@@H](CSC1=CC(=C(C=C1N)OC2=CC=C(C=C2)O)NS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)