CAS 110054-70-1 is the registry number for 1-Methyl-10H-phenoselenazine, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
1-methyl-10H-phenoselenazine (CAS 110054-70-1) is a chemical compound with the molecular formula C13H11NSe and a molecular weight of 260.20 g/mol. IUPAC name: 1-methyl-10H-phenoselenazine. InChIKey: YALDOISQBIOCMB-UHFFFAOYSA-N.
| Molecular formula | C13H11NSe |
|---|---|
| Molecular weight | 260.20 g/mol |
| IUPAC name | 1-methyl-10H-phenoselenazine |
| InChIKey | YALDOISQBIOCMB-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)[Se]C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)