CAS 112260-63-6 is the registry number for (4R,5S)-4-(iodomethyl)-2,2,5-trimethyl-1,3-dioxolane, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(4R,5S)-4-(iodomethyl)-2,2,5-trimethyl-1,3-dioxolane (CAS 112260-63-6) is a chemical compound with the molecular formula C7H13IO2 and a molecular weight of 256.08 g/mol. IUPAC name: (4R,5S)-4-(iodomethyl)-2,2,5-trimethyl-1,3-dioxolane. InChIKey: RXECALQARXRLCW-WDSKDSINSA-N.
| Molecular formula | C7H13IO2 |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | (4R,5S)-4-(iodomethyl)-2,2,5-trimethyl-1,3-dioxolane |
| InChIKey | RXECALQARXRLCW-WDSKDSINSA-N |
| SMILES | C[C@H]1[C@@H](OC(O1)(C)C)CI |
Computed by PubChem (NCBI)