Products 1122639-04-6

CAS 1122639-04-6 is the registry number for Bis(2-hydroxyethyl) furan-2,5-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Bis(2-hydroxyethyl) furan-2,5-dicarboxylate (CAS 1122639-04-6) is a chemical compound with the molecular formula C10H12O7 and a molecular weight of 244.20 g/mol. IUPAC name: bis(2-hydroxyethyl) furan-2,5-dicarboxylate. InChIKey: LGCKSNYTFLNOIN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O7
Molecular weight244.20 g/mol
IUPAC namebis(2-hydroxyethyl) furan-2,5-dicarboxylate
InChIKeyLGCKSNYTFLNOIN-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)C(=O)OCCO)C(=O)OCCO

Computed by PubChem (NCBI)