CAS 1129971-87-4 appears in our catalog under these names: 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium hexafluorophosphate(V), 98%, 98%, Morpholinium, 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methyl-, hexafluorophosphate(1-) (1:1), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium hexafluorophosphate (CAS 1129971-87-4) is a chemical compound with the molecular formula C10H17F6N4O3P and a molecular weight of 386.23 g/mol. IUPAC name: 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium hexafluorophosphate. InChIKey: CWICMEYLJIWBCY-UHFFFAOYSA-N.
| Molecular formula | C10H17F6N4O3P |
|---|---|
| Molecular weight | 386.23 g/mol |
| IUPAC name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium hexafluorophosphate |
| InChIKey | CWICMEYLJIWBCY-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCOCC1)C2=NC(=NC(=N2)OC)OC.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)