Products 1132825-58-1
CAS 1132825-58-1 is the registry number for Tert-butyl (4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)carbamate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
Tert-butyl N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 1132825-58-1) is a chemical compound with the molecular formula C18H28BNO4 and a molecular weight of 333.2 g/mol. IUPAC name: tert-butyl N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: AHCUEEMTQRHXNH-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO4 |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | tert-butyl N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | AHCUEEMTQRHXNH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)