CAS 1138835-40-1 is the registry number for 5'-(tert-Butyl)-[1,1':3',1''-terphenyl]-3,3''-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3-(3-aminophenyl)-5-tert-butylphenyl]aniline (CAS 1138835-40-1) is a chemical compound with the molecular formula C22H24N2 and a molecular weight of 316.4 g/mol. IUPAC name: 3-[3-(3-aminophenyl)-5-tert-butylphenyl]aniline. InChIKey: OBMGLLLDGCXBJP-UHFFFAOYSA-N.
| Molecular formula | C22H24N2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 3-[3-(3-aminophenyl)-5-tert-butylphenyl]aniline |
| InChIKey | OBMGLLLDGCXBJP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C2=CC(=CC=C2)N)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)