CAS 114123-74-9 is the registry number for Rubber Oligomer 7. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(2R,3R)-1,1,5,5-tetramethyl-2-prop-1-en-2-yl-3-(2,2,4-trimethylpentyl)cyclohexane (CAS 114123-74-9) is a chemical compound with the molecular formula C21H40 and a molecular weight of 292.5 g/mol. IUPAC name: cis-(2R,3R)-1,1,5,5-tetramethyl-2-prop-1-en-2-yl-3-(2,2,4-trimethylpentyl)cyclohexane. InChIKey: RKIRUWUUGLPTCW-MSOLQXFVSA-N.
| Molecular formula | C21H40 |
|---|---|
| Molecular weight | 292.5 g/mol |
| IUPAC name | cis-(2R,3R)-1,1,5,5-tetramethyl-2-prop-1-en-2-yl-3-(2,2,4-trimethylpentyl)cyclohexane |
| InChIKey | RKIRUWUUGLPTCW-MSOLQXFVSA-N |
| SMILES | CC(C)CC(C)(C)C[C@@H]1CC(CC([C@H]1C(=C)C)(C)C)(C)C |
Computed by PubChem (NCBI)